C13H11Cl2N3O — CID 59151543
5-chloro-1-[(4-chlorophenyl)methyl]-2-iminopyridine-3-carboxamide (PubChem CID 59151543) has the molecular formula C13H11Cl2N3O and a molecular weight of 296.16 g/mol. Its IUPAC name is 5-chloro-1-[(4-chlorophenyl)methyl]-2-iminopyridine-3-carboxamide.
| Compound Name | 5-chloro-1-[(4-chlorophenyl)methyl]-2-iminopyridine-3-carboxamide |
|---|---|
| PubChem CID | 59151543 |
| Molecular Formula | C13H11Cl2N3O |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 5-chloro-1-[(4-chlorophenyl)methyl]-2-iminopyridine-3-carboxamide |
| SMILES | [H]/N=c1/c(C(N)=O)cc(Cl)cn1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H11Cl2N3O/c14-9-3-1-8(2-4-9)6-18-7-10(15)5-11(12(18)16)13(17)19/h1-5,7,16H,6H2,(H2,17,19)/b16-12- |
| InChIKey | FTLQLJNUXOEDBT-VBKFSLOCSA-N |
| XLogP | 2.42 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |