About 5-chloro-1-[2-(3,4-dichlorophenoxy)propyl]-2-iminopyridine-3-carboxamide
5-chloro-1-[2-(3,4-dichlorophenoxy)propyl]-2-iminopyridine-3-carboxamide (PubChem CID 59151632) has the molecular formula C15H14Cl3N3O2
and a molecular weight of 374.66 g/mol. Its IUPAC name is 5-chloro-1-[2-(3,4-dichlorophenoxy)propyl]-2-iminopyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5-chloro-1-[2-(3,4-dichlorophenoxy)propyl]-2-iminopyridine-3-carboxamide |
| PubChem CID | 59151632 |
| Molecular Formula | C15H14Cl3N3O2 |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 5-chloro-1-[2-(3,4-dichlorophenoxy)propyl]-2-iminopyridine-3-carboxamide |
| SMILES | [H]/N=c1/c(C(N)=O)cc(Cl)cn1CC(C)Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H14Cl3N3O2/c1-8(23-10-2-3-12(17)13(18)5-10)6-21-7-9(16)4-11(14(21)19)15(20)22/h2-5,7-8,19H,6H2,1H3,(H2,20,22)/b19-14- |
| InChIKey | WUKUZJRIDLENNR-RGEXLXHISA-N |
| XLogP | 3.49 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-1-[2-(3,4-dichlorophenoxy)propyl]-2-iminopyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-[2-(3,4-dichlorophenoxy)propyl]-2-iminopyridine-3-carboxamide?
The IUPAC name of 5-chloro-1-[2-(3,4-dichlorophenoxy)propyl]-2-iminopyridine-3-carboxamide (CID 59151632) is 5-chloro-1-[2-(3,4-dichlorophenoxy)propyl]-2-iminopyridine-3-carboxamide.
What is the SMILES notation for 5-chloro-1-[2-(3,4-dichlorophenoxy)propyl]-2-iminopyridine-3-carboxamide?
The canonical SMILES for 5-chloro-1-[2-(3,4-dichlorophenoxy)propyl]-2-iminopyridine-3-carboxamide is [H]/N=c1/c(C(N)=O)cc(Cl)cn1CC(C)Oc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 5-chloro-1-[2-(3,4-dichlorophenoxy)propyl]-2-iminopyridine-3-carboxamide?
The InChIKey is WUKUZJRIDLENNR-RGEXLXHISA-N. The full InChI is InChI=1S/C15H14Cl3N3O2/c1-8(23-10-2-3-12(17)13(18)5-10)6-21-7-9(16)4-11(14(21)19)15(20)22/h2-5,7-8,19H,6H2,1H3,(H2,20,22)/b19-14-.
What are the key properties of 5-chloro-1-[2-(3,4-dichlorophenoxy)propyl]-2-iminopyridine-3-carboxamide?
5-chloro-1-[2-(3,4-dichlorophenoxy)propyl]-2-iminopyridine-3-carboxamide has a molecular weight of 374.66 g/mol, XLogP of 3.49, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-[2-(3,4-dichlorophenoxy)propyl]-2-iminopyridine-3-carboxamide is sourced from PubChem (CID 59151632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).