C40H39N3O5 — CID 59152028
3-[4-[4-(3-benzyl-8-methylquinolin-4-yl)phenoxy]butyl]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-ethylimidazolidine-2,4-dione (PubChem CID 59152028) has the molecular formula C40H39N3O5 and a molecular weight of 641.77 g/mol. Its IUPAC name is 3-[4-[4-(3-benzyl-8-methylquinolin-4-yl)phenoxy]butyl]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-ethylimidazolidine-2,4-dione.
| Compound Name | 3-[4-[4-(3-benzyl-8-methylquinolin-4-yl)phenoxy]butyl]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59152028 |
| Molecular Formula | C40H39N3O5 |
| Molecular Weight | 641.77 g/mol |
| Exact Mass | 641.29 |
| IUPAC Name | 3-[4-[4-(3-benzyl-8-methylquinolin-4-yl)phenoxy]butyl]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-ethylimidazolidine-2,4-dione |
| SMILES | CCC1(c2ccc3c(c2)OCCO3)NC(=O)N(CCCCOc2ccc(-c3c(Cc4ccccc4)cnc4c(C)cccc34)cc2)C1=O |
| InChI | InChI=1S/C40H39N3O5/c1-3-40(31-16-19-34-35(25-31)48-23-22-47-34)38(44)43(39(45)42-40)20-7-8-21-46-32-17-14-29(15-18-32)36-30(24-28-11-5-4-6-12-28)26-41-37-27(2)10-9-13-33(36)37/h4-6,9-19,25-26H,3,7-8,20-24H2,1-2H3,(H,42,45) |
| InChIKey | NZGKZOLYWBFIIG-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.77 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|