C23H24ClFN4O3S — CID 59152229
4-(3-chloro-2-fluorophenoxy)-N-methoxy-1-[[6-(1,3-thiazol-2-ylamino)-2-pyridinyl]methyl]cyclohexane-1-carboxamide (PubChem CID 59152229) has the molecular formula C23H24ClFN4O3S and a molecular weight of 490.99 g/mol. Its IUPAC name is 4-(3-chloro-2-fluorophenoxy)-N-methoxy-1-[[6-(1,3-thiazol-2-ylamino)-2-pyridinyl]methyl]cyclohexane-1-carboxamide.
| Compound Name | 4-(3-chloro-2-fluorophenoxy)-N-methoxy-1-[[6-(1,3-thiazol-2-ylamino)-2-pyridinyl]methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 59152229 |
| Molecular Formula | C23H24ClFN4O3S |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 4-(3-chloro-2-fluorophenoxy)-N-methoxy-1-[[6-(1,3-thiazol-2-ylamino)-2-pyridinyl]methyl]cyclohexane-1-carboxamide |
| SMILES | CONC(=O)C1(Cc2cccc(Nc3nccs3)n2)CCC(Oc2cccc(Cl)c2F)CC1 |
| InChI | InChI=1S/C23H24ClFN4O3S/c1-31-29-21(30)23(14-15-4-2-7-19(27-15)28-22-26-12-13-33-22)10-8-16(9-11-23)32-18-6-3-5-17(24)20(18)25/h2-7,12-13,16H,8-11,14H2,1H3,(H,29,30)(H,26,27,28) |
| InChIKey | ZWRIWNSRFLBBOD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|