C16H23N — CID 59152622
5-[[(2R,4aS)-4a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]methyl]-3H-pyrrole (PubChem CID 59152622) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 5-[[(2R,4aS)-4a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]methyl]-3H-pyrrole.
| Compound Name | 5-[[(2R,4aS)-4a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]methyl]-3H-pyrrole |
|---|---|
| PubChem CID | 59152622 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 5-[[(2R,4aS)-4a-methyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]methyl]-3H-pyrrole |
| SMILES | C[C@@]12CCCCC1=C[C@@H](CC1=CCC=N1)CC2 |
| InChI | InChI=1S/C16H23N/c1-16-8-3-2-5-14(16)11-13(7-9-16)12-15-6-4-10-17-15/h6,10-11,13H,2-5,7-9,12H2,1H3/t13-,16-/m0/s1 |
| InChIKey | OXKNFGPYAFXYIV-BBRMVZONSA-N |
| XLogP | 4.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|