C20H30N6O3 — CID 59152795
2,2-dideuterio-N-[1-[2,2-dideuterio-2-(4-ethyl-5-oxotetrazol-1-yl)ethyl]-4-(trideuteriomethoxy)piperidin-4-yl]-N-(2,3,4,5,6-pentadeuteriophenyl)propanamide (PubChem CID 59152795) has the molecular formula C20H30N6O3 and a molecular weight of 414.57 g/mol. Its IUPAC name is 2,2-dideuterio-N-[1-[2,2-dideuterio-2-(4-ethyl-5-oxotetrazol-1-yl)ethyl]-4-(trideuteriomethoxy)piperidin-4-yl]-N-(2,3,4,5,6-pentadeuteriophenyl)propanamide.
| Compound Name | 2,2-dideuterio-N-[1-[2,2-dideuterio-2-(4-ethyl-5-oxotetrazol-1-yl)ethyl]-4-(trideuteriomethoxy)piperidin-4-yl]-N-(2,3,4,5,6-pentadeuteriophenyl)propanamide |
|---|---|
| PubChem CID | 59152795 |
| Molecular Formula | C20H30N6O3 |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | 2,2-dideuterio-N-[1-[2,2-dideuterio-2-(4-ethyl-5-oxotetrazol-1-yl)ethyl]-4-(trideuteriomethoxy)piperidin-4-yl]-N-(2,3,4,5,6-pentadeuteriophenyl)propanamide |
| SMILES | [2H]c1c([2H])c([2H])c(N(C(=O)C([2H])([2H])C)C2(OC([2H])([2H])[2H])CCN(CC([2H])([2H])n3nnn(CC)c3=O)CC2)c([2H])c1[2H] |
| InChI | InChI=1S/C20H30N6O3/c1-4-18(27)26(17-9-7-6-8-10-17)20(29-3)11-13-23(14-12-20)15-16-25-19(28)24(5-2)21-22-25/h6-10H,4-5,11-16H2,1-3H3/i3D3,4D2,6D,7D,8D,9D,10D,16D2 |
| InChIKey | ZKZHWTFPVIUOSK-YNZGRQCPSA-N |
| XLogP | 1.34 |
| TPSA | 85.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|