C17H17NO2 — CID 59153336
methyl (4E)-4-benzylidene-1,5,6,7-tetrahydroindole-2-carboxylate (PubChem CID 59153336) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is methyl (4E)-4-benzylidene-1,5,6,7-tetrahydroindole-2-carboxylate.
| Compound Name | methyl (4E)-4-benzylidene-1,5,6,7-tetrahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 59153336 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | methyl (4E)-4-benzylidene-1,5,6,7-tetrahydroindole-2-carboxylate |
| SMILES | COC(=O)c1cc2c([nH]1)CCC/C2=C\c1ccccc1 |
| InChI | InChI=1S/C17H17NO2/c1-20-17(19)16-11-14-13(8-5-9-15(14)18-16)10-12-6-3-2-4-7-12/h2-4,6-7,10-11,18H,5,8-9H2,1H3/b13-10+ |
| InChIKey | YJZYUDIDBRVOPF-JLHYYAGUSA-N |
| XLogP | 3.68 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |