C26H26F3NO2 — CID 59153418
2-(dibenzylamino)-1-(difluoromethoxy)-5-(4-fluorophenyl)pentan-3-one (PubChem CID 59153418) has the molecular formula C26H26F3NO2 and a molecular weight of 441.49 g/mol. Its IUPAC name is 2-(dibenzylamino)-1-(difluoromethoxy)-5-(4-fluorophenyl)pentan-3-one.
| Compound Name | 2-(dibenzylamino)-1-(difluoromethoxy)-5-(4-fluorophenyl)pentan-3-one |
|---|---|
| PubChem CID | 59153418 |
| Molecular Formula | C26H26F3NO2 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 2-(dibenzylamino)-1-(difluoromethoxy)-5-(4-fluorophenyl)pentan-3-one |
| SMILES | O=C(CCc1ccc(F)cc1)C(COC(F)F)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H26F3NO2/c27-23-14-11-20(12-15-23)13-16-25(31)24(19-32-26(28)29)30(17-21-7-3-1-4-8-21)18-22-9-5-2-6-10-22/h1-12,14-15,24,26H,13,16-19H2 |
| InChIKey | PETIUJXFQXNTIU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |