C26H25F4NO2 — CID 59153424
2-(dibenzylamino)-1-(difluoromethoxy)-5-(3,4-difluorophenyl)pentan-3-one (PubChem CID 59153424) has the molecular formula C26H25F4NO2 and a molecular weight of 459.48 g/mol. Its IUPAC name is 2-(dibenzylamino)-1-(difluoromethoxy)-5-(3,4-difluorophenyl)pentan-3-one.
| Compound Name | 2-(dibenzylamino)-1-(difluoromethoxy)-5-(3,4-difluorophenyl)pentan-3-one |
|---|---|
| PubChem CID | 59153424 |
| Molecular Formula | C26H25F4NO2 |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 2-(dibenzylamino)-1-(difluoromethoxy)-5-(3,4-difluorophenyl)pentan-3-one |
| SMILES | O=C(CCc1ccc(F)c(F)c1)C(COC(F)F)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H25F4NO2/c27-22-13-11-19(15-23(22)28)12-14-25(32)24(18-33-26(29)30)31(16-20-7-3-1-4-8-20)17-21-9-5-2-6-10-21/h1-11,13,15,24,26H,12,14,16-18H2 |
| InChIKey | KYUHFZHAWMCVFY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |