C22H34O3Si — CID 59153448
methyl (9E,11E)-7-[tert-butyl(dimethyl)silyl]oxy-8-methyltetradeca-9,11-dien-4,13-diynoate (PubChem CID 59153448) has the molecular formula C22H34O3Si and a molecular weight of 374.60 g/mol. Its IUPAC name is methyl (9E,11E)-7-[tert-butyl(dimethyl)silyl]oxy-8-methyltetradeca-9,11-dien-4,13-diynoate.
| Compound Name | methyl (9E,11E)-7-[tert-butyl(dimethyl)silyl]oxy-8-methyltetradeca-9,11-dien-4,13-diynoate |
|---|---|
| PubChem CID | 59153448 |
| Molecular Formula | C22H34O3Si |
| Molecular Weight | 374.60 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | methyl (9E,11E)-7-[tert-butyl(dimethyl)silyl]oxy-8-methyltetradeca-9,11-dien-4,13-diynoate |
| SMILES | C#C/C=C/C=C/C(C)C(CC#CCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H34O3Si/c1-9-10-11-13-16-19(2)20(25-26(7,8)22(3,4)5)17-14-12-15-18-21(23)24-6/h1,10-11,13,16,19-20H,15,17-18H2,2-8H3/b11-10+,16-13+ |
| InChIKey | OTEVNBQTCOUMSZ-QDTXCPDVSA-N |
| XLogP | 5.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|