C25H47IO4Si2 — CID 59153459
methyl (7E,9E,11E)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-12-iodododeca-7,9,11-trienoate (PubChem CID 59153459) has the molecular formula C25H47IO4Si2 and a molecular weight of 594.72 g/mol. Its IUPAC name is methyl (7E,9E,11E)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-12-iodododeca-7,9,11-trienoate.
| Compound Name | methyl (7E,9E,11E)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-12-iodododeca-7,9,11-trienoate |
|---|---|
| PubChem CID | 59153459 |
| Molecular Formula | C25H47IO4Si2 |
| Molecular Weight | 594.72 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | methyl (7E,9E,11E)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-12-iodododeca-7,9,11-trienoate |
| SMILES | COC(=O)CCCC(O[Si](C)(C)C(C)(C)C)C(/C=C/C=C/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H47IO4Si2/c1-24(2,3)31(8,9)29-21(17-14-12-13-15-20-26)22(18-16-19-23(27)28-7)30-32(10,11)25(4,5)6/h12-15,17,20-22H,16,18-19H2,1-11H3/b13-12+,17-14+,20-15+ |
| InChIKey | YAAZUEDZDIPXJS-VRCIFSACSA-N |
| XLogP | 8.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.72 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|