C20H32OSi — CID 59153464
tert-butyl-dimethyl-[(8E,10E)-7-methyltrideca-8,10-dien-3,12-diyn-6-yl]oxysilane (PubChem CID 59153464) has the molecular formula C20H32OSi and a molecular weight of 316.56 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(8E,10E)-7-methyltrideca-8,10-dien-3,12-diyn-6-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(8E,10E)-7-methyltrideca-8,10-dien-3,12-diyn-6-yl]oxysilane |
|---|---|
| PubChem CID | 59153464 |
| Molecular Formula | C20H32OSi |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | tert-butyl-dimethyl-[(8E,10E)-7-methyltrideca-8,10-dien-3,12-diyn-6-yl]oxysilane |
| SMILES | C#C/C=C/C=C/C(C)C(CC#CCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H32OSi/c1-9-11-13-15-16-18(3)19(17-14-12-10-2)21-22(7,8)20(4,5)6/h1,11,13,15-16,18-19H,10,17H2,2-8H3/b13-11+,16-15+ |
| InChIKey | YIPLVFKTSSFWFL-FYNKLQMPSA-N |
| XLogP | 5.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|