C18H30O3 — CID 59153486
(1R,3aR,7aR)-1-[(2R)-5-(1,3-dioxolan-2-yl)pentan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 59153486) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (1R,3aR,7aR)-1-[(2R)-5-(1,3-dioxolan-2-yl)pentan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,3aR,7aR)-1-[(2R)-5-(1,3-dioxolan-2-yl)pentan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 59153486 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (1R,3aR,7aR)-1-[(2R)-5-(1,3-dioxolan-2-yl)pentan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | C[C@H](CCCC1OCCO1)[C@H]1CC[C@H]2C(=O)CCC[C@]12C |
| InChI | InChI=1S/C18H30O3/c1-13(5-3-7-17-20-11-12-21-17)14-8-9-15-16(19)6-4-10-18(14,15)2/h13-15,17H,3-12H2,1-2H3/t13-,14-,15+,18-/m1/s1 |
| InChIKey | RDUCWMLCPKTFCO-ZXFNITATSA-N |
| XLogP | 3.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |