C16H22F8O3 — CID 59153591
(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluorocyclopentane-1-carboxylate (PubChem CID 59153591) has the molecular formula C16H22F8O3 and a molecular weight of 414.33 g/mol. Its IUPAC name is (5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluorocyclopentane-1-carboxylate.
| Compound Name | (5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluorocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 59153591 |
| Molecular Formula | C16H22F8O3 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluorocyclopentane-1-carboxylate |
| SMILES | CCC1CC(C(=O)OC(C)CC(C)(O)C(F)(F)F)C(F)(F)C1(F)C(C)(F)F |
| InChI | InChI=1S/C16H22F8O3/c1-5-9-6-10(15(20,21)14(9,19)13(4,17)18)11(25)27-8(2)7-12(3,26)16(22,23)24/h8-10,26H,5-7H2,1-4H3 |
| InChIKey | BRTKXBLDEWUGGV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |