C10H14F6O2 — CID 59153599
(Z)-1,1,1,7,7,7-hexafluoro-2,4,6-trimethylhept-3-ene-2,6-diol (PubChem CID 59153599) has the molecular formula C10H14F6O2 and a molecular weight of 280.21 g/mol. Its IUPAC name is (Z)-1,1,1,7,7,7-hexafluoro-2,4,6-trimethylhept-3-ene-2,6-diol.
| Compound Name | (Z)-1,1,1,7,7,7-hexafluoro-2,4,6-trimethylhept-3-ene-2,6-diol |
|---|---|
| PubChem CID | 59153599 |
| Molecular Formula | C10H14F6O2 |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (Z)-1,1,1,7,7,7-hexafluoro-2,4,6-trimethylhept-3-ene-2,6-diol |
| SMILES | C/C(=C/C(C)(O)C(F)(F)F)CC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C10H14F6O2/c1-6(4-7(2,17)9(11,12)13)5-8(3,18)10(14,15)16/h4,17-18H,5H2,1-3H3/b6-4- |
| InChIKey | FKUPGIULSJILIU-XQRVVYSFSA-N |
| XLogP | 2.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|