C19H29F5O4 — CID 59153627
ditert-butyl 3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluorocyclopentane-1,1-dicarboxylate (PubChem CID 59153627) has the molecular formula C19H29F5O4 and a molecular weight of 416.43 g/mol. Its IUPAC name is ditert-butyl 3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluorocyclopentane-1,1-dicarboxylate.
| Compound Name | ditert-butyl 3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluorocyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 59153627 |
| Molecular Formula | C19H29F5O4 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | ditert-butyl 3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluorocyclopentane-1,1-dicarboxylate |
| SMILES | CCC1CC(C(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)C(F)(F)C1(F)C(C)(F)F |
| InChI | InChI=1S/C19H29F5O4/c1-9-11-10-17(12(25)27-14(2,3)4,13(26)28-15(5,6)7)19(23,24)18(11,22)16(8,20)21/h11H,9-10H2,1-8H3 |
| InChIKey | UYIFBKJVLUWZMQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|