C24H39N3O9P+ — CID 59153663
2-[[1-[[1-[(1-carboxy-2-phenylethyl)amino]-1-oxopropan-2-yl]amino]-3-(2-methylprop-2-enoyloxy)propan-2-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 59153663) has the molecular formula C24H39N3O9P+ and a molecular weight of 544.56 g/mol. Its IUPAC name is 2-[[1-[[1-[(1-carboxy-2-phenylethyl)amino]-1-oxopropan-2-yl]amino]-3-(2-methylprop-2-enoyloxy)propan-2-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[1-[[1-[(1-carboxy-2-phenylethyl)amino]-1-oxopropan-2-yl]amino]-3-(2-methylprop-2-enoyloxy)propan-2-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 59153663 |
| Molecular Formula | C24H39N3O9P+ |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 2-[[1-[[1-[(1-carboxy-2-phenylethyl)amino]-1-oxopropan-2-yl]amino]-3-(2-methylprop-2-enoyloxy)propan-2-yl]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | C=C(C)C(=O)OCC(CNC(C)C(=O)NC(Cc1ccccc1)C(=O)O)OP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C24H38N3O9P/c1-17(2)24(31)34-16-20(36-37(32,33)35-13-12-27(4,5)6)15-25-18(3)22(28)26-21(23(29)30)14-19-10-8-7-9-11-19/h7-11,18,20-21,25H,1,12-16H2,2-6H3,(H2-,26,28,29,30,32,33)/p+1 |
| InChIKey | VEUGFEOUHUGUCS-UHFFFAOYSA-O |
| XLogP | 1.10 |
| TPSA | 160.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|