C14H20F3N5O2 — CID 59153783
3-N,5-N-dibutyl-6-(trifluoromethyl)-1,2,4-triazine-3,5-dicarboxamide (PubChem CID 59153783) has the molecular formula C14H20F3N5O2 and a molecular weight of 347.34 g/mol. Its IUPAC name is 3-N,5-N-dibutyl-6-(trifluoromethyl)-1,2,4-triazine-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-dibutyl-6-(trifluoromethyl)-1,2,4-triazine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 59153783 |
| Molecular Formula | C14H20F3N5O2 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 3-N,5-N-dibutyl-6-(trifluoromethyl)-1,2,4-triazine-3,5-dicarboxamide |
| SMILES | CCCCNC(=O)c1nnc(C(F)(F)F)c(C(=O)NCCCC)n1 |
| InChI | InChI=1S/C14H20F3N5O2/c1-3-5-7-18-12(23)9-10(14(15,16)17)21-22-11(20-9)13(24)19-8-6-4-2/h3-8H2,1-2H3,(H,18,23)(H,19,24) |
| InChIKey | VFOMWXBOJBKVIG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|