C31H33F3N6O3S — CID 59154096
(2S)-4-[7,8-dimethyl-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]quinolin-4-yl]oxy-N-hex-5-enyl-1-(imidazole-1-carbonyl)-N-methylpyrrolidine-2-carboxamide (PubChem CID 59154096) has the molecular formula C31H33F3N6O3S and a molecular weight of 626.71 g/mol. Its IUPAC name is (2S)-4-[7,8-dimethyl-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]quinolin-4-yl]oxy-N-hex-5-enyl-1-(imidazole-1-carbonyl)-N-methylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-4-[7,8-dimethyl-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]quinolin-4-yl]oxy-N-hex-5-enyl-1-(imidazole-1-carbonyl)-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59154096 |
| Molecular Formula | C31H33F3N6O3S |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 626.23 |
| IUPAC Name | (2S)-4-[7,8-dimethyl-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]quinolin-4-yl]oxy-N-hex-5-enyl-1-(imidazole-1-carbonyl)-N-methylpyrrolidine-2-carboxamide |
| SMILES | C=CCCCCN(C)C(=O)[C@@H]1CC(Oc2cc(-c3nc(C(F)(F)F)cs3)nc3c(C)c(C)ccc23)CN1C(=O)n1ccnc1 |
| InChI | InChI=1S/C31H33F3N6O3S/c1-5-6-7-8-12-38(4)29(41)24-14-21(16-40(24)30(42)39-13-11-35-18-39)43-25-15-23(28-37-26(17-44-28)31(32,33)34)36-27-20(3)19(2)9-10-22(25)27/h5,9-11,13,15,17-18,21,24H,1,6-8,12,14,16H2,2-4H3/t21?,24-/m0/s1 |
| InChIKey | RSLOLUOHTZCUDM-FHZUCYEKSA-N |
| XLogP | 6.50 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|