C32H39F3N4O4S — CID 59154113
tert-butyl (2S)-4-[7,8-dimethyl-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]quinolin-4-yl]oxy-2-[hex-5-enyl(methyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 59154113) has the molecular formula C32H39F3N4O4S and a molecular weight of 632.75 g/mol. Its IUPAC name is tert-butyl (2S)-4-[7,8-dimethyl-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]quinolin-4-yl]oxy-2-[hex-5-enyl(methyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-[7,8-dimethyl-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]quinolin-4-yl]oxy-2-[hex-5-enyl(methyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59154113 |
| Molecular Formula | C32H39F3N4O4S |
| Molecular Weight | 632.75 g/mol |
| Exact Mass | 632.26 |
| IUPAC Name | tert-butyl (2S)-4-[7,8-dimethyl-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]quinolin-4-yl]oxy-2-[hex-5-enyl(methyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCCCCN(C)C(=O)[C@@H]1CC(Oc2cc(-c3nc(C(F)(F)F)cs3)nc3c(C)c(C)ccc23)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H39F3N4O4S/c1-8-9-10-11-14-38(7)29(40)24-15-21(17-39(24)30(41)43-31(4,5)6)42-25-16-23(28-37-26(18-44-28)32(33,34)35)36-27-20(3)19(2)12-13-22(25)27/h8,12-13,16,18,21,24H,1,9-11,14-15,17H2,2-7H3/t21?,24-/m0/s1 |
| InChIKey | DUMCUUZDDZCHIN-FHZUCYEKSA-N |
| XLogP | 7.57 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.75 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|