C27H31F3N4O2S — CID 59154141
(2S)-4-[7,8-dimethyl-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]quinolin-4-yl]oxy-N-hex-5-enyl-N-methylpyrrolidine-2-carboxamide (PubChem CID 59154141) has the molecular formula C27H31F3N4O2S and a molecular weight of 532.63 g/mol. Its IUPAC name is (2S)-4-[7,8-dimethyl-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]quinolin-4-yl]oxy-N-hex-5-enyl-N-methylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-4-[7,8-dimethyl-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]quinolin-4-yl]oxy-N-hex-5-enyl-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59154141 |
| Molecular Formula | C27H31F3N4O2S |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | (2S)-4-[7,8-dimethyl-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]quinolin-4-yl]oxy-N-hex-5-enyl-N-methylpyrrolidine-2-carboxamide |
| SMILES | C=CCCCCN(C)C(=O)[C@@H]1CC(Oc2cc(-c3nc(C(F)(F)F)cs3)nc3c(C)c(C)ccc23)CN1 |
| InChI | InChI=1S/C27H31F3N4O2S/c1-5-6-7-8-11-34(4)26(35)21-12-18(14-31-21)36-22-13-20(25-33-23(15-37-25)27(28,29)30)32-24-17(3)16(2)9-10-19(22)24/h5,9-10,13,15,18,21,31H,1,6-8,11-12,14H2,2-4H3/t18?,21-/m0/s1 |
| InChIKey | IVKAOPOVJXSGRO-ZYZRXSCRSA-N |
| XLogP | 5.92 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|