C22H27BrN7O3S+ — CID 59154191
1-[3-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-9-ium-9-yl]-1-cyclopropylpropyl]-3-propan-2-ylurea (PubChem CID 59154191) has the molecular formula C22H27BrN7O3S+ and a molecular weight of 549.48 g/mol. Its IUPAC name is 1-[3-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-9-ium-9-yl]-1-cyclopropylpropyl]-3-propan-2-ylurea.
| Compound Name | 1-[3-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-9-ium-9-yl]-1-cyclopropylpropyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 59154191 |
| Molecular Formula | C22H27BrN7O3S+ |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | 1-[3-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-9-ium-9-yl]-1-cyclopropylpropyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NC(CC[n+]1c(Sc2cc3c(cc2Br)OCO3)[nH]c2c(N)ncnc21)C1CC1 |
| InChI | InChI=1S/C22H26BrN7O3S/c1-11(2)27-21(31)28-14(12-3-4-12)5-6-30-20-18(19(24)25-9-26-20)29-22(30)34-17-8-16-15(7-13(17)23)32-10-33-16/h7-9,11-12,14H,3-6,10H2,1-2H3,(H4,24,25,26,27,28,31)/p+1 |
| InChIKey | MXYHHNWYDZTTMN-UHFFFAOYSA-O |
| XLogP | 3.35 |
| TPSA | 131.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|