About 1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane
1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane (PubChem CID 59154322) has the molecular formula C28H30
and a molecular weight of 366.55 g/mol. Its IUPAC name is 1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane.
Molecular Properties
| Compound Name | 1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane |
| PubChem CID | 59154322 |
| Molecular Formula | C28H30 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane |
| SMILES | C(C#CC#CC12CC3CC(CC(C3)C1)C2)#CC#CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H30/c1(3-5-7-27-15-21-9-22(16-27)11-23(10-21)17-27)2-4-6-8-28-18-24-12-25(19-28)14-26(13-24)20-28/h21-26H,9-20H2 |
| InChIKey | NZCFONTURATRPN-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane?
The IUPAC name of 1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane (CID 59154322) is 1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane.
What is the SMILES notation for 1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane?
The canonical SMILES for 1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane is C(C#CC#CC12CC3CC(CC(C3)C1)C2)#CC#CC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane?
The InChIKey is NZCFONTURATRPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30/c1(3-5-7-27-15-21-9-22(16-27)11-23(10-21)17-27)2-4-6-8-28-18-24-12-25(19-28)14-26(13-24)20-28/h21-26H,9-20H2.
What are the key properties of 1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane?
1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane has a molecular weight of 366.55 g/mol, XLogP of 5.43, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane is sourced from PubChem (CID 59154322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).