C28H30 — CID 59154322
1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane (PubChem CID 59154322) has the molecular formula C28H30 and a molecular weight of 366.55 g/mol. Its IUPAC name is 1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane.
| Compound Name | 1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane |
|---|---|
| PubChem CID | 59154322 |
| Molecular Formula | C28H30 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 1-[8-(1-adamantyl)octa-1,3,5,7-tetraynyl]adamantane |
| SMILES | C(C#CC#CC12CC3CC(CC(C3)C1)C2)#CC#CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H30/c1(3-5-7-27-15-21-9-22(16-27)11-23(10-21)17-27)2-4-6-8-28-18-24-12-25(19-28)14-26(13-24)20-28/h21-26H,9-20H2 |
| InChIKey | NZCFONTURATRPN-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|