C24H40N2O7 — CID 59154575
(1S,2R,5R,7R,8R,9R,11R,13R,14R)-15-amino-2-ethyl-9-methoxy-1,5,7,8,9,11,13-heptamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone (PubChem CID 59154575) has the molecular formula C24H40N2O7 and a molecular weight of 468.59 g/mol. Its IUPAC name is (1S,2R,5R,7R,8R,9R,11R,13R,14R)-15-amino-2-ethyl-9-methoxy-1,5,7,8,9,11,13-heptamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone.
| Compound Name | (1S,2R,5R,7R,8R,9R,11R,13R,14R)-15-amino-2-ethyl-9-methoxy-1,5,7,8,9,11,13-heptamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
|---|---|
| PubChem CID | 59154575 |
| Molecular Formula | C24H40N2O7 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | (1S,2R,5R,7R,8R,9R,11R,13R,14R)-15-amino-2-ethyl-9-methoxy-1,5,7,8,9,11,13-heptamethyl-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C(=O)[C@H](C)[C@@H](C)[C@](C)(OC)C[C@@H](C)C(=O)[C@H](C)[C@H]2N(N)C(=O)O[C@]12C |
| InChI | InChI=1S/C24H40N2O7/c1-10-17-24(8)20(26(25)22(30)33-24)14(4)18(27)12(2)11-23(7,31-9)16(6)13(3)19(28)15(5)21(29)32-17/h12-17,20H,10-11,25H2,1-9H3/t12-,13-,14+,15-,16-,17-,20-,23-,24-/m1/s1 |
| InChIKey | IBUCMKQPQJMVBK-IYTUSZSLSA-N |
| XLogP | 2.89 |
| TPSA | 125.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|