About 4-cyclopropyl-1-[4-(5,5-dimethylhexyl)phenyl]triazole
4-cyclopropyl-1-[4-(5,5-dimethylhexyl)phenyl]triazole (PubChem CID 59154582) has the molecular formula C19H27N3
and a molecular weight of 297.45 g/mol. Its IUPAC name is 4-cyclopropyl-1-[4-(5,5-dimethylhexyl)phenyl]triazole.
Molecular Properties
| Compound Name | 4-cyclopropyl-1-[4-(5,5-dimethylhexyl)phenyl]triazole |
| PubChem CID | 59154582 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 4-cyclopropyl-1-[4-(5,5-dimethylhexyl)phenyl]triazole |
| SMILES | CC(C)(C)CCCCc1ccc(-n2cc(C3CC3)nn2)cc1 |
| InChI | InChI=1S/C19H27N3/c1-19(2,3)13-5-4-6-15-7-11-17(12-8-15)22-14-18(20-21-22)16-9-10-16/h7-8,11-12,14,16H,4-6,9-10,13H2,1-3H3 |
| InChIKey | BJNSXSWUBDGOFJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopropyl-1-[4-(5,5-dimethylhexyl)phenyl]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-1-[4-(5,5-dimethylhexyl)phenyl]triazole?
The IUPAC name of 4-cyclopropyl-1-[4-(5,5-dimethylhexyl)phenyl]triazole (CID 59154582) is 4-cyclopropyl-1-[4-(5,5-dimethylhexyl)phenyl]triazole.
What is the SMILES notation for 4-cyclopropyl-1-[4-(5,5-dimethylhexyl)phenyl]triazole?
The canonical SMILES for 4-cyclopropyl-1-[4-(5,5-dimethylhexyl)phenyl]triazole is CC(C)(C)CCCCc1ccc(-n2cc(C3CC3)nn2)cc1.
What is the InChIKey of 4-cyclopropyl-1-[4-(5,5-dimethylhexyl)phenyl]triazole?
The InChIKey is BJNSXSWUBDGOFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3/c1-19(2,3)13-5-4-6-15-7-11-17(12-8-15)22-14-18(20-21-22)16-9-10-16/h7-8,11-12,14,16H,4-6,9-10,13H2,1-3H3.
What are the key properties of 4-cyclopropyl-1-[4-(5,5-dimethylhexyl)phenyl]triazole?
4-cyclopropyl-1-[4-(5,5-dimethylhexyl)phenyl]triazole has a molecular weight of 297.45 g/mol, XLogP of 4.90, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-1-[4-(5,5-dimethylhexyl)phenyl]triazole is sourced from PubChem (CID 59154582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).