About 2-[1-[4-(5,5-dimethylhexyl)phenyl]triazol-4-yl]pyridine
2-[1-[4-(5,5-dimethylhexyl)phenyl]triazol-4-yl]pyridine (PubChem CID 59154747) has the molecular formula C21H26N4
and a molecular weight of 334.47 g/mol. Its IUPAC name is 2-[1-[4-(5,5-dimethylhexyl)phenyl]triazol-4-yl]pyridine.
Molecular Properties
| Compound Name | 2-[1-[4-(5,5-dimethylhexyl)phenyl]triazol-4-yl]pyridine |
| PubChem CID | 59154747 |
| Molecular Formula | C21H26N4 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 2-[1-[4-(5,5-dimethylhexyl)phenyl]triazol-4-yl]pyridine |
| SMILES | CC(C)(C)CCCCc1ccc(-n2cc(-c3ccccn3)nn2)cc1 |
| InChI | InChI=1S/C21H26N4/c1-21(2,3)14-6-4-8-17-10-12-18(13-11-17)25-16-20(23-24-25)19-9-5-7-15-22-19/h5,7,9-13,15-16H,4,6,8,14H2,1-3H3 |
| InChIKey | FDUBVLIUYWLYFF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[4-(5,5-dimethylhexyl)phenyl]triazol-4-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[4-(5,5-dimethylhexyl)phenyl]triazol-4-yl]pyridine?
The IUPAC name of 2-[1-[4-(5,5-dimethylhexyl)phenyl]triazol-4-yl]pyridine (CID 59154747) is 2-[1-[4-(5,5-dimethylhexyl)phenyl]triazol-4-yl]pyridine.
What is the SMILES notation for 2-[1-[4-(5,5-dimethylhexyl)phenyl]triazol-4-yl]pyridine?
The canonical SMILES for 2-[1-[4-(5,5-dimethylhexyl)phenyl]triazol-4-yl]pyridine is CC(C)(C)CCCCc1ccc(-n2cc(-c3ccccn3)nn2)cc1.
What is the InChIKey of 2-[1-[4-(5,5-dimethylhexyl)phenyl]triazol-4-yl]pyridine?
The InChIKey is FDUBVLIUYWLYFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4/c1-21(2,3)14-6-4-8-17-10-12-18(13-11-17)25-16-20(23-24-25)19-9-5-7-15-22-19/h5,7,9-13,15-16H,4,6,8,14H2,1-3H3.
What are the key properties of 2-[1-[4-(5,5-dimethylhexyl)phenyl]triazol-4-yl]pyridine?
2-[1-[4-(5,5-dimethylhexyl)phenyl]triazol-4-yl]pyridine has a molecular weight of 334.47 g/mol, XLogP of 5.09, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[4-(5,5-dimethylhexyl)phenyl]triazol-4-yl]pyridine is sourced from PubChem (CID 59154747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).