About 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-(methoxymethyl)benzene
1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-(methoxymethyl)benzene (PubChem CID 59154888) has the molecular formula C12H16FN3O2
and a molecular weight of 253.28 g/mol. Its IUPAC name is 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-(methoxymethyl)benzene.
Molecular Properties
| Compound Name | 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-(methoxymethyl)benzene |
| PubChem CID | 59154888 |
| Molecular Formula | C12H16FN3O2 |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-(methoxymethyl)benzene |
| SMILES | COCc1ccc([C@@H](OC)[C@@H](CF)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C12H16FN3O2/c1-17-8-9-3-5-10(6-4-9)12(18-2)11(7-13)15-16-14/h3-6,11-12H,7-8H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | YUFOVUXHQZJALZ-VXGBXAGGSA-N |
| XLogP | 3.17 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-(methoxymethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-(methoxymethyl)benzene?
The IUPAC name of 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-(methoxymethyl)benzene (CID 59154888) is 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-(methoxymethyl)benzene.
What is the SMILES notation for 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-(methoxymethyl)benzene?
The canonical SMILES for 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-(methoxymethyl)benzene is COCc1ccc([C@@H](OC)[C@@H](CF)N=[N+]=[N-])cc1.
What is the InChIKey of 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-(methoxymethyl)benzene?
The InChIKey is YUFOVUXHQZJALZ-VXGBXAGGSA-N. The full InChI is InChI=1S/C12H16FN3O2/c1-17-8-9-3-5-10(6-4-9)12(18-2)11(7-13)15-16-14/h3-6,11-12H,7-8H2,1-2H3/t11-,12-/m1/s1.
What are the key properties of 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-(methoxymethyl)benzene?
1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-(methoxymethyl)benzene has a molecular weight of 253.28 g/mol, XLogP of 3.17, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-(methoxymethyl)benzene is sourced from PubChem (CID 59154888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).