About N-ethyl-N-(1,2-oxazol-5-ylmethyl)hydroxylamine
N-ethyl-N-(1,2-oxazol-5-ylmethyl)hydroxylamine (PubChem CID 59154889) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is N-ethyl-N-(1,2-oxazol-5-ylmethyl)hydroxylamine.
Molecular Properties
| Compound Name | N-ethyl-N-(1,2-oxazol-5-ylmethyl)hydroxylamine |
| PubChem CID | 59154889 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | N-ethyl-N-(1,2-oxazol-5-ylmethyl)hydroxylamine |
| SMILES | CCN(O)Cc1ccno1 |
| InChI | InChI=1S/C6H10N2O2/c1-2-8(9)5-6-3-4-7-10-6/h3-4,9H,2,5H2,1H3 |
| InChIKey | SZOSMZGFEZOELZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-(1,2-oxazol-5-ylmethyl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-(1,2-oxazol-5-ylmethyl)hydroxylamine?
The IUPAC name of N-ethyl-N-(1,2-oxazol-5-ylmethyl)hydroxylamine (CID 59154889) is N-ethyl-N-(1,2-oxazol-5-ylmethyl)hydroxylamine.
What is the SMILES notation for N-ethyl-N-(1,2-oxazol-5-ylmethyl)hydroxylamine?
The canonical SMILES for N-ethyl-N-(1,2-oxazol-5-ylmethyl)hydroxylamine is CCN(O)Cc1ccno1.
What is the InChIKey of N-ethyl-N-(1,2-oxazol-5-ylmethyl)hydroxylamine?
The InChIKey is SZOSMZGFEZOELZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2/c1-2-8(9)5-6-3-4-7-10-6/h3-4,9H,2,5H2,1H3.
What are the key properties of N-ethyl-N-(1,2-oxazol-5-ylmethyl)hydroxylamine?
N-ethyl-N-(1,2-oxazol-5-ylmethyl)hydroxylamine has a molecular weight of 142.16 g/mol, XLogP of 0.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-(1,2-oxazol-5-ylmethyl)hydroxylamine is sourced from PubChem (CID 59154889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).