About 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrazole
1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrazole (PubChem CID 59154899) has the molecular formula C13H14FN5O
and a molecular weight of 275.29 g/mol. Its IUPAC name is 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrazole.
Molecular Properties
| Compound Name | 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrazole |
| PubChem CID | 59154899 |
| Molecular Formula | C13H14FN5O |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrazole |
| SMILES | CO[C@H](c1ccc(-n2cccn2)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C13H14FN5O/c1-20-13(12(9-14)17-18-15)10-3-5-11(6-4-10)19-8-2-7-16-19/h2-8,12-13H,9H2,1H3/t12-,13-/m1/s1 |
| InChIKey | GNLYIXITGYIKKZ-CHWSQXEVSA-N |
| XLogP | 3.21 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrazole?
The IUPAC name of 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrazole (CID 59154899) is 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrazole.
What is the SMILES notation for 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrazole?
The canonical SMILES for 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrazole is CO[C@H](c1ccc(-n2cccn2)cc1)[C@@H](CF)N=[N+]=[N-].
What is the InChIKey of 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrazole?
The InChIKey is GNLYIXITGYIKKZ-CHWSQXEVSA-N. The full InChI is InChI=1S/C13H14FN5O/c1-20-13(12(9-14)17-18-15)10-3-5-11(6-4-10)19-8-2-7-16-19/h2-8,12-13H,9H2,1H3/t12-,13-/m1/s1.
What are the key properties of 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrazole?
1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrazole has a molecular weight of 275.29 g/mol, XLogP of 3.21, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]pyrazole is sourced from PubChem (CID 59154899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).