About 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]sulfonylpyrrolidine
1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]sulfonylpyrrolidine (PubChem CID 59154938) has the molecular formula C14H19FN4O3S
and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]sulfonylpyrrolidine.
Molecular Properties
| Compound Name | 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]sulfonylpyrrolidine |
| PubChem CID | 59154938 |
| Molecular Formula | C14H19FN4O3S |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]sulfonylpyrrolidine |
| SMILES | CO[C@H](c1ccc(S(=O)(=O)N2CCCC2)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C14H19FN4O3S/c1-22-14(13(10-15)17-18-16)11-4-6-12(7-5-11)23(20,21)19-8-2-3-9-19/h4-7,13-14H,2-3,8-10H2,1H3/t13-,14-/m1/s1 |
| InChIKey | QVPSOYBXLZMZJV-ZIAGYGMSSA-N |
| XLogP | 2.81 |
| TPSA | 95.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]sulfonylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]sulfonylpyrrolidine?
The IUPAC name of 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]sulfonylpyrrolidine (CID 59154938) is 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]sulfonylpyrrolidine.
What is the SMILES notation for 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]sulfonylpyrrolidine?
The canonical SMILES for 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]sulfonylpyrrolidine is CO[C@H](c1ccc(S(=O)(=O)N2CCCC2)cc1)[C@@H](CF)N=[N+]=[N-].
What is the InChIKey of 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]sulfonylpyrrolidine?
The InChIKey is QVPSOYBXLZMZJV-ZIAGYGMSSA-N. The full InChI is InChI=1S/C14H19FN4O3S/c1-22-14(13(10-15)17-18-16)11-4-6-12(7-5-11)23(20,21)19-8-2-3-9-19/h4-7,13-14H,2-3,8-10H2,1H3/t13-,14-/m1/s1.
What are the key properties of 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]sulfonylpyrrolidine?
1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]sulfonylpyrrolidine has a molecular weight of 342.40 g/mol, XLogP of 2.81, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]sulfonylpyrrolidine is sourced from PubChem (CID 59154938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).