C14H20FN3O — CID 59154958
1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-butylbenzene (PubChem CID 59154958) has the molecular formula C14H20FN3O and a molecular weight of 265.33 g/mol. Its IUPAC name is 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-butylbenzene.
| Compound Name | 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-butylbenzene |
|---|---|
| PubChem CID | 59154958 |
| Molecular Formula | C14H20FN3O |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 1-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]-4-butylbenzene |
| SMILES | CCCCc1ccc([C@@H](OC)[C@@H](CF)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C14H20FN3O/c1-3-4-5-11-6-8-12(9-7-11)14(19-2)13(10-15)17-18-16/h6-9,13-14H,3-5,10H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | QSJQDCFANADVFY-ZIAGYGMSSA-N |
| XLogP | 4.37 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|