About N-ethyl-N-(3,4,4-trifluorobut-3-enyl)hydroxylamine
N-ethyl-N-(3,4,4-trifluorobut-3-enyl)hydroxylamine (PubChem CID 59155006) has the molecular formula C6H10F3NO
and a molecular weight of 169.15 g/mol. Its IUPAC name is N-ethyl-N-(3,4,4-trifluorobut-3-enyl)hydroxylamine.
Molecular Properties
| Compound Name | N-ethyl-N-(3,4,4-trifluorobut-3-enyl)hydroxylamine |
| PubChem CID | 59155006 |
| Molecular Formula | C6H10F3NO |
| Molecular Weight | 169.15 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | N-ethyl-N-(3,4,4-trifluorobut-3-enyl)hydroxylamine |
| SMILES | CCN(O)CCC(F)=C(F)F |
| InChI | InChI=1S/C6H10F3NO/c1-2-10(11)4-3-5(7)6(8)9/h11H,2-4H2,1H3 |
| InChIKey | GEGOFDFQGCZRIX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.15 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-(3,4,4-trifluorobut-3-enyl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-(3,4,4-trifluorobut-3-enyl)hydroxylamine?
The IUPAC name of N-ethyl-N-(3,4,4-trifluorobut-3-enyl)hydroxylamine (CID 59155006) is N-ethyl-N-(3,4,4-trifluorobut-3-enyl)hydroxylamine.
What is the SMILES notation for N-ethyl-N-(3,4,4-trifluorobut-3-enyl)hydroxylamine?
The canonical SMILES for N-ethyl-N-(3,4,4-trifluorobut-3-enyl)hydroxylamine is CCN(O)CCC(F)=C(F)F.
What is the InChIKey of N-ethyl-N-(3,4,4-trifluorobut-3-enyl)hydroxylamine?
The InChIKey is GEGOFDFQGCZRIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F3NO/c1-2-10(11)4-3-5(7)6(8)9/h11H,2-4H2,1H3.
What are the key properties of N-ethyl-N-(3,4,4-trifluorobut-3-enyl)hydroxylamine?
N-ethyl-N-(3,4,4-trifluorobut-3-enyl)hydroxylamine has a molecular weight of 169.15 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-(3,4,4-trifluorobut-3-enyl)hydroxylamine is sourced from PubChem (CID 59155006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).