About 4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzenecarboximidamide
4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzenecarboximidamide (PubChem CID 59155010) has the molecular formula C11H14FN5O
and a molecular weight of 251.27 g/mol. Its IUPAC name is 4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzenecarboximidamide.
Molecular Properties
| Compound Name | 4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzenecarboximidamide |
| PubChem CID | 59155010 |
| Molecular Formula | C11H14FN5O |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc([C@@H](OC)[C@@H](CF)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C11H14FN5O/c1-18-10(9(6-12)16-17-15)7-2-4-8(5-3-7)11(13)14/h2-5,9-10H,6H2,1H3,(H3,13,14)/t9-,10-/m1/s1 |
| InChIKey | WVKOPQBMVAHUQK-NXEZZACHSA-N |
| XLogP | 2.31 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzenecarboximidamide?
The IUPAC name of 4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzenecarboximidamide (CID 59155010) is 4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzenecarboximidamide.
What is the SMILES notation for 4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzenecarboximidamide?
The canonical SMILES for 4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzenecarboximidamide is [H]/N=C(\N)c1ccc([C@@H](OC)[C@@H](CF)N=[N+]=[N-])cc1.
What is the InChIKey of 4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzenecarboximidamide?
The InChIKey is WVKOPQBMVAHUQK-NXEZZACHSA-N. The full InChI is InChI=1S/C11H14FN5O/c1-18-10(9(6-12)16-17-15)7-2-4-8(5-3-7)11(13)14/h2-5,9-10H,6H2,1H3,(H3,13,14)/t9-,10-/m1/s1.
What are the key properties of 4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzenecarboximidamide?
4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzenecarboximidamide has a molecular weight of 251.27 g/mol, XLogP of 2.31, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]benzenecarboximidamide is sourced from PubChem (CID 59155010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).