About N-ethyl-3,3-difluoroprop-2-en-1-amine
N-ethyl-3,3-difluoroprop-2-en-1-amine (PubChem CID 59155019) has the molecular formula C5H9F2N
and a molecular weight of 121.13 g/mol. Its IUPAC name is N-ethyl-3,3-difluoroprop-2-en-1-amine.
Molecular Properties
| Compound Name | N-ethyl-3,3-difluoroprop-2-en-1-amine |
| PubChem CID | 59155019 |
| Molecular Formula | C5H9F2N |
| Molecular Weight | 121.13 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | N-ethyl-3,3-difluoroprop-2-en-1-amine |
| SMILES | CCNCC=C(F)F |
| InChI | InChI=1S/C5H9F2N/c1-2-8-4-3-5(6)7/h3,8H,2,4H2,1H3 |
| InChIKey | IZXHWELLPHAPJU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.13 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3,3-difluoroprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3,3-difluoroprop-2-en-1-amine?
The IUPAC name of N-ethyl-3,3-difluoroprop-2-en-1-amine (CID 59155019) is N-ethyl-3,3-difluoroprop-2-en-1-amine.
What is the SMILES notation for N-ethyl-3,3-difluoroprop-2-en-1-amine?
The canonical SMILES for N-ethyl-3,3-difluoroprop-2-en-1-amine is CCNCC=C(F)F.
What is the InChIKey of N-ethyl-3,3-difluoroprop-2-en-1-amine?
The InChIKey is IZXHWELLPHAPJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F2N/c1-2-8-4-3-5(6)7/h3,8H,2,4H2,1H3.
What are the key properties of N-ethyl-3,3-difluoroprop-2-en-1-amine?
N-ethyl-3,3-difluoroprop-2-en-1-amine has a molecular weight of 121.13 g/mol, XLogP of 1.38, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3,3-difluoroprop-2-en-1-amine is sourced from PubChem (CID 59155019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).