C15H19FN4O — CID 59155039
4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1,2,3,6-tetrahydropyridine (PubChem CID 59155039) has the molecular formula C15H19FN4O and a molecular weight of 290.34 g/mol. Its IUPAC name is 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 59155039 |
| Molecular Formula | C15H19FN4O |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1,2,3,6-tetrahydropyridine |
| SMILES | CO[C@H](c1ccc(C2=CCNCC2)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C15H19FN4O/c1-21-15(14(10-16)19-20-17)13-4-2-11(3-5-13)12-6-8-18-9-7-12/h2-6,14-15,18H,7-10H2,1H3/t14-,15-/m1/s1 |
| InChIKey | ZKVYDTBOZYGMCU-HUUCEWRRSA-N |
| XLogP | 3.40 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|