About [4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]phenyl]methanol
[4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]phenyl]methanol (PubChem CID 59155104) has the molecular formula C17H18FN3O2
and a molecular weight of 315.35 g/mol. Its IUPAC name is [4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]phenyl]methanol |
| PubChem CID | 59155104 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | [4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]phenyl]methanol |
| SMILES | CO[C@H](c1ccc(-c2ccc(CO)cc2)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C17H18FN3O2/c1-23-17(16(10-18)20-21-19)15-8-6-14(7-9-15)13-4-2-12(11-22)3-5-13/h2-9,16-17,22H,10-11H2,1H3/t16-,17-/m1/s1 |
| InChIKey | MSLZMLRSFHECDS-IAGOWNOFSA-N |
| XLogP | 4.18 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]phenyl]methanol?
The IUPAC name of [4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]phenyl]methanol (CID 59155104) is [4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]phenyl]methanol.
What is the SMILES notation for [4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]phenyl]methanol?
The canonical SMILES for [4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]phenyl]methanol is CO[C@H](c1ccc(-c2ccc(CO)cc2)cc1)[C@@H](CF)N=[N+]=[N-].
What is the InChIKey of [4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]phenyl]methanol?
The InChIKey is MSLZMLRSFHECDS-IAGOWNOFSA-N. The full InChI is InChI=1S/C17H18FN3O2/c1-23-17(16(10-18)20-21-19)15-8-6-14(7-9-15)13-4-2-12(11-22)3-5-13/h2-9,16-17,22H,10-11H2,1H3/t16-,17-/m1/s1.
What are the key properties of [4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]phenyl]methanol?
[4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]phenyl]methanol has a molecular weight of 315.35 g/mol, XLogP of 4.18, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]phenyl]methanol is sourced from PubChem (CID 59155104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).