About 1-ethylsulfanyl-2,3-difluoropropane
1-ethylsulfanyl-2,3-difluoropropane (PubChem CID 59155139) has the molecular formula C5H10F2S
and a molecular weight of 140.20 g/mol. Its IUPAC name is 1-ethylsulfanyl-2,3-difluoropropane.
Molecular Properties
| Compound Name | 1-ethylsulfanyl-2,3-difluoropropane |
| PubChem CID | 59155139 |
| Molecular Formula | C5H10F2S |
| Molecular Weight | 140.20 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | 1-ethylsulfanyl-2,3-difluoropropane |
| SMILES | CCSCC(F)CF |
| InChI | InChI=1S/C5H10F2S/c1-2-8-4-5(7)3-6/h5H,2-4H2,1H3 |
| InChIKey | JHDJSJPKXZZETN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethylsulfanyl-2,3-difluoropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylsulfanyl-2,3-difluoropropane?
The IUPAC name of 1-ethylsulfanyl-2,3-difluoropropane (CID 59155139) is 1-ethylsulfanyl-2,3-difluoropropane.
What is the SMILES notation for 1-ethylsulfanyl-2,3-difluoropropane?
The canonical SMILES for 1-ethylsulfanyl-2,3-difluoropropane is CCSCC(F)CF.
What is the InChIKey of 1-ethylsulfanyl-2,3-difluoropropane?
The InChIKey is JHDJSJPKXZZETN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10F2S/c1-2-8-4-5(7)3-6/h5H,2-4H2,1H3.
What are the key properties of 1-ethylsulfanyl-2,3-difluoropropane?
1-ethylsulfanyl-2,3-difluoropropane has a molecular weight of 140.20 g/mol, XLogP of 2.05, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylsulfanyl-2,3-difluoropropane is sourced from PubChem (CID 59155139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).