About pentyl 3-phosphanylpropanoate
pentyl 3-phosphanylpropanoate (PubChem CID 59155334) has the molecular formula C8H17O2P
and a molecular weight of 176.20 g/mol. Its IUPAC name is pentyl 3-phosphanylpropanoate.
Molecular Properties
| Compound Name | pentyl 3-phosphanylpropanoate |
| PubChem CID | 59155334 |
| Molecular Formula | C8H17O2P |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | pentyl 3-phosphanylpropanoate |
| SMILES | CCCCCOC(=O)CCP |
| InChI | InChI=1S/C8H17O2P/c1-2-3-4-6-10-8(9)5-7-11/h2-7,11H2,1H3 |
| InChIKey | DTULUEZAEVFVRS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze pentyl 3-phosphanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl 3-phosphanylpropanoate?
The IUPAC name of pentyl 3-phosphanylpropanoate (CID 59155334) is pentyl 3-phosphanylpropanoate.
What is the SMILES notation for pentyl 3-phosphanylpropanoate?
The canonical SMILES for pentyl 3-phosphanylpropanoate is CCCCCOC(=O)CCP.
What is the InChIKey of pentyl 3-phosphanylpropanoate?
The InChIKey is DTULUEZAEVFVRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17O2P/c1-2-3-4-6-10-8(9)5-7-11/h2-7,11H2,1H3.
What are the key properties of pentyl 3-phosphanylpropanoate?
pentyl 3-phosphanylpropanoate has a molecular weight of 176.20 g/mol, XLogP of 1.99, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl 3-phosphanylpropanoate is sourced from PubChem (CID 59155334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).