C88H122N4 — CID 59155445
2-[7-[4-[7-(4,6-dimethylpyrimidin-2-yl)-9,9-dioctylfluoren-2-yl]-2,5-dihexylphenyl]-9,9-dioctylfluoren-2-yl]-4,6-dimethylpyrimidine (PubChem CID 59155445) has the molecular formula C88H122N4 and a molecular weight of 1235.97 g/mol. Its IUPAC name is 2-[7-[4-[7-(4,6-dimethylpyrimidin-2-yl)-9,9-dioctylfluoren-2-yl]-2,5-dihexylphenyl]-9,9-dioctylfluoren-2-yl]-4,6-dimethylpyrimidine.
| Compound Name | 2-[7-[4-[7-(4,6-dimethylpyrimidin-2-yl)-9,9-dioctylfluoren-2-yl]-2,5-dihexylphenyl]-9,9-dioctylfluoren-2-yl]-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 59155445 |
| Molecular Formula | C88H122N4 |
| Molecular Weight | 1235.97 g/mol |
| Exact Mass | 1234.97 |
| IUPAC Name | 2-[7-[4-[7-(4,6-dimethylpyrimidin-2-yl)-9,9-dioctylfluoren-2-yl]-2,5-dihexylphenyl]-9,9-dioctylfluoren-2-yl]-4,6-dimethylpyrimidine |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(-c3nc(C)cc(C)n3)ccc2-c2ccc(-c3cc(CCCCCC)c(-c4ccc5c(c4)C(CCCCCCCC)(CCCCCCCC)c4cc(-c6nc(C)cc(C)n6)ccc4-5)cc3CCCCCC)cc21 |
| InChI | InChI=1S/C88H122N4/c1-11-17-23-29-33-39-53-87(54-40-34-30-24-18-12-2)81-61-71(45-49-75(81)77-51-47-73(63-83(77)87)85-89-65(7)57-66(8)90-85)79-59-70(44-38-28-22-16-6)80(60-69(79)43-37-27-21-15-5)72-46-50-76-78-52-48-74(86-91-67(9)58-68(10)92-86)64-84(78)88(82(76)62-72,55-41-35-31-25-19-13-3)56-42-36-32-26-20-14-4/h45-52,57-64H,11-44,53-56H2,1-10H3 |
| InChIKey | QPJPMUATXFONPB-UHFFFAOYSA-N |
| XLogP | 26.95 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1235.97 |
| LogP ≤ 5 | 26.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|