About 3-diethoxyphosphoryl-2,5-dimethylthiophene
3-diethoxyphosphoryl-2,5-dimethylthiophene (PubChem CID 59155825) has the molecular formula C10H17O3PS
and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-2,5-dimethylthiophene.
Molecular Properties
| Compound Name | 3-diethoxyphosphoryl-2,5-dimethylthiophene |
| PubChem CID | 59155825 |
| Molecular Formula | C10H17O3PS |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 3-diethoxyphosphoryl-2,5-dimethylthiophene |
| SMILES | CCOP(=O)(OCC)c1cc(C)sc1C |
| InChI | InChI=1S/C10H17O3PS/c1-5-12-14(11,13-6-2)10-7-8(3)15-9(10)4/h7H,5-6H2,1-4H3 |
| InChIKey | JECJLSYFBANEGO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-diethoxyphosphoryl-2,5-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diethoxyphosphoryl-2,5-dimethylthiophene?
The IUPAC name of 3-diethoxyphosphoryl-2,5-dimethylthiophene (CID 59155825) is 3-diethoxyphosphoryl-2,5-dimethylthiophene.
What is the SMILES notation for 3-diethoxyphosphoryl-2,5-dimethylthiophene?
The canonical SMILES for 3-diethoxyphosphoryl-2,5-dimethylthiophene is CCOP(=O)(OCC)c1cc(C)sc1C.
What is the InChIKey of 3-diethoxyphosphoryl-2,5-dimethylthiophene?
The InChIKey is JECJLSYFBANEGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17O3PS/c1-5-12-14(11,13-6-2)10-7-8(3)15-9(10)4/h7H,5-6H2,1-4H3.
What are the key properties of 3-diethoxyphosphoryl-2,5-dimethylthiophene?
3-diethoxyphosphoryl-2,5-dimethylthiophene has a molecular weight of 248.28 g/mol, XLogP of 3.26, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diethoxyphosphoryl-2,5-dimethylthiophene is sourced from PubChem (CID 59155825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).