C20H14O6P2S5 — CID 59155876
[4-phosphono-2,5-bis(5-thiophen-2-ylthiophen-2-yl)thiophen-3-yl]phosphonic acid (PubChem CID 59155876) has the molecular formula C20H14O6P2S5 and a molecular weight of 572.61 g/mol. Its IUPAC name is [4-phosphono-2,5-bis(5-thiophen-2-ylthiophen-2-yl)thiophen-3-yl]phosphonic acid.
| Compound Name | [4-phosphono-2,5-bis(5-thiophen-2-ylthiophen-2-yl)thiophen-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 59155876 |
| Molecular Formula | C20H14O6P2S5 |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 571.89 |
| IUPAC Name | [4-phosphono-2,5-bis(5-thiophen-2-ylthiophen-2-yl)thiophen-3-yl]phosphonic acid |
| SMILES | O=P(O)(O)c1c(-c2ccc(-c3cccs3)s2)sc(-c2ccc(-c3cccs3)s2)c1P(=O)(O)O |
| InChI | InChI=1S/C20H14O6P2S5/c21-27(22,23)17-18(28(24,25)26)20(16-8-6-14(32-16)12-4-2-10-30-12)33-19(17)15-7-5-13(31-15)11-3-1-9-29-11/h1-10H,(H2,21,22,23)(H2,24,25,26) |
| InChIKey | DFIPKWLDYIDGAE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|