C38H38O6P2S7 — CID 59155879
3,4-bis(diethoxyphosphoryl)-2,5-bis[5-[5-(5-methylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophene (PubChem CID 59155879) has the molecular formula C38H38O6P2S7 and a molecular weight of 877.13 g/mol. Its IUPAC name is 3,4-bis(diethoxyphosphoryl)-2,5-bis[5-[5-(5-methylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophene.
| Compound Name | 3,4-bis(diethoxyphosphoryl)-2,5-bis[5-[5-(5-methylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophene |
|---|---|
| PubChem CID | 59155879 |
| Molecular Formula | C38H38O6P2S7 |
| Molecular Weight | 877.13 g/mol |
| Exact Mass | 876.02 |
| IUPAC Name | 3,4-bis(diethoxyphosphoryl)-2,5-bis[5-[5-(5-methylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophene |
| SMILES | CCOP(=O)(OCC)c1c(-c2ccc(-c3ccc(-c4ccc(C)s4)s3)s2)sc(-c2ccc(-c3ccc(-c4ccc(C)s4)s3)s2)c1P(=O)(OCC)OCC |
| InChI | InChI=1S/C38H38O6P2S7/c1-7-41-45(39,42-8-2)35-36(46(40,43-9-3)44-10-4)38(34-22-20-32(52-34)30-18-16-28(50-30)26-14-12-24(6)48-26)53-37(35)33-21-19-31(51-33)29-17-15-27(49-29)25-13-11-23(5)47-25/h11-22H,7-10H2,1-6H3 |
| InChIKey | YPIPBAKYRHXLCW-UHFFFAOYSA-N |
| XLogP | 14.52 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.13 |
| LogP ≤ 5 | 14.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|