C44H42N4S5 — CID 59156087
8-[(E)-2-(4-hexylphenyl)ethenyl]-4-[[8-[(E)-2-(4-hexylphenyl)ethenyl]-[1,3]thiazolo[5,4-f][1,3]benzothiazol-4-yl]sulfanyl]-[1,3]thiazolo[5,4-f][1,3]benzothiazole (PubChem CID 59156087) has the molecular formula C44H42N4S5 and a molecular weight of 787.18 g/mol. Its IUPAC name is 8-[(E)-2-(4-hexylphenyl)ethenyl]-4-[[8-[(E)-2-(4-hexylphenyl)ethenyl]-[1,3]thiazolo[5,4-f][1,3]benzothiazol-4-yl]sulfanyl]-[1,3]thiazolo[5,4-f][1,3]benzothiazole.
| Compound Name | 8-[(E)-2-(4-hexylphenyl)ethenyl]-4-[[8-[(E)-2-(4-hexylphenyl)ethenyl]-[1,3]thiazolo[5,4-f][1,3]benzothiazol-4-yl]sulfanyl]-[1,3]thiazolo[5,4-f][1,3]benzothiazole |
|---|---|
| PubChem CID | 59156087 |
| Molecular Formula | C44H42N4S5 |
| Molecular Weight | 787.18 g/mol |
| Exact Mass | 786.20 |
| IUPAC Name | 8-[(E)-2-(4-hexylphenyl)ethenyl]-4-[[8-[(E)-2-(4-hexylphenyl)ethenyl]-[1,3]thiazolo[5,4-f][1,3]benzothiazol-4-yl]sulfanyl]-[1,3]thiazolo[5,4-f][1,3]benzothiazole |
| SMILES | CCCCCCc1ccc(/C=C/c2c3ncsc3c(Sc3c4ncsc4c(/C=C/c4ccc(CCCCCC)cc4)c4ncsc34)c3ncsc23)cc1 |
| InChI | InChI=1S/C44H42N4S5/c1-3-5-7-9-11-29-13-17-31(18-14-29)21-23-33-35-41(51-25-45-35)43(37-39(33)49-27-47-37)53-44-38-40(50-28-48-38)34(36-42(44)52-26-46-36)24-22-32-19-15-30(16-20-32)12-10-8-6-4-2/h13-28H,3-12H2,1-2H3/b23-21+,24-22+ |
| InChIKey | ORWKVPTZWCQXFK-MBALSZOMSA-N |
| XLogP | 14.86 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.18 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|