C38H14F6N6 — CID 59156137
(2E)-2-[(12Z)-12-[cyano(isocyano)methylidene]-2,8-bis[6-(trifluoromethyl)-3-pyridinyl]indeno[1,2-b]fluoren-6-ylidene]-2-isocyanoacetonitrile (PubChem CID 59156137) has the molecular formula C38H14F6N6 and a molecular weight of 668.56 g/mol. Its IUPAC name is (2E)-2-[(12Z)-12-[cyano(isocyano)methylidene]-2,8-bis[6-(trifluoromethyl)-3-pyridinyl]indeno[1,2-b]fluoren-6-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2E)-2-[(12Z)-12-[cyano(isocyano)methylidene]-2,8-bis[6-(trifluoromethyl)-3-pyridinyl]indeno[1,2-b]fluoren-6-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 59156137 |
| Molecular Formula | C38H14F6N6 |
| Molecular Weight | 668.56 g/mol |
| Exact Mass | 668.12 |
| IUPAC Name | (2E)-2-[(12Z)-12-[cyano(isocyano)methylidene]-2,8-bis[6-(trifluoromethyl)-3-pyridinyl]indeno[1,2-b]fluoren-6-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1/c2cc(-c3ccc(C(F)(F)F)nc3)ccc2-c2cc3c(cc21)-c1ccc(-c2ccc(C(F)(F)F)nc2)cc1/C3=C(/C#N)[N+]#[C-] |
| InChI | InChI=1S/C38H14F6N6/c1-47-31(15-45)35-27-11-19(21-5-9-33(49-17-21)37(39,40)41)3-7-23(27)25-14-30-26(13-29(25)35)24-8-4-20(12-28(24)36(30)32(16-46)48-2)22-6-10-34(50-18-22)38(42,43)44/h3-14,17-18H/b35-31-,36-32+ |
| InChIKey | RQCAKJHJTDBBRI-KDJHSEOYSA-N |
| XLogP | 10.21 |
| TPSA | 82.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.56 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|