About magnesium 2-[9-(2-oxidophenyl)-1,10-phenanthroline-1,10-diium-2-yl]phenolate
magnesium 2-[9-(2-oxidophenyl)-1,10-phenanthroline-1,10-diium-2-yl]phenolate (PubChem CID 59156361) has the molecular formula C24H16MgN2O2+2
and a molecular weight of 388.71 g/mol. Its IUPAC name is magnesium 2-[9-(2-oxidophenyl)-1,10-phenanthroline-1,10-diium-2-yl]phenolate.
Molecular Properties
| Compound Name | magnesium 2-[9-(2-oxidophenyl)-1,10-phenanthroline-1,10-diium-2-yl]phenolate |
| PubChem CID | 59156361 |
| Molecular Formula | C24H16MgN2O2+2 |
| Molecular Weight | 388.71 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | magnesium 2-[9-(2-oxidophenyl)-1,10-phenanthroline-1,10-diium-2-yl]phenolate |
| SMILES | [Mg+2].[O-]c1ccccc1-c1ccc2ccc3ccc(-c4ccccc4[O-])[nH+]c3c2[nH+]1 |
| InChI | InChI=1S/C24H16N2O2.Mg/c27-21-7-3-1-5-17(21)19-13-11-15-9-10-16-12-14-20(26-24(16)23(15)25-19)18-6-2-4-8-22(18)28;/h1-14,27-28H;/q;+2 |
| InChIKey | XAYMGBLLSYTMED-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.71 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze magnesium 2-[9-(2-oxidophenyl)-1,10-phenanthroline-1,10-diium-2-yl]phenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium 2-[9-(2-oxidophenyl)-1,10-phenanthroline-1,10-diium-2-yl]phenolate?
The IUPAC name of magnesium 2-[9-(2-oxidophenyl)-1,10-phenanthroline-1,10-diium-2-yl]phenolate (CID 59156361) is magnesium 2-[9-(2-oxidophenyl)-1,10-phenanthroline-1,10-diium-2-yl]phenolate.
What is the SMILES notation for magnesium 2-[9-(2-oxidophenyl)-1,10-phenanthroline-1,10-diium-2-yl]phenolate?
The canonical SMILES for magnesium 2-[9-(2-oxidophenyl)-1,10-phenanthroline-1,10-diium-2-yl]phenolate is [Mg+2].[O-]c1ccccc1-c1ccc2ccc3ccc(-c4ccccc4[O-])[nH+]c3c2[nH+]1.
What is the InChIKey of magnesium 2-[9-(2-oxidophenyl)-1,10-phenanthroline-1,10-diium-2-yl]phenolate?
The InChIKey is XAYMGBLLSYTMED-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16N2O2.Mg/c27-21-7-3-1-5-17(21)19-13-11-15-9-10-16-12-14-20(26-24(16)23(15)25-19)18-6-2-4-8-22(18)28;/h1-14,27-28H;/q;+2.
What are the key properties of magnesium 2-[9-(2-oxidophenyl)-1,10-phenanthroline-1,10-diium-2-yl]phenolate?
magnesium 2-[9-(2-oxidophenyl)-1,10-phenanthroline-1,10-diium-2-yl]phenolate has a molecular weight of 388.71 g/mol, XLogP of 2.72, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium 2-[9-(2-oxidophenyl)-1,10-phenanthroline-1,10-diium-2-yl]phenolate is sourced from PubChem (CID 59156361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).