About lithium 2-(4,7-diphenyl-1,10-phenanthrolin-1-ium-2-yl)phenolate
lithium 2-(4,7-diphenyl-1,10-phenanthrolin-1-ium-2-yl)phenolate (PubChem CID 59156368) has the molecular formula C30H20LiN2O+
and a molecular weight of 431.44 g/mol. Its IUPAC name is lithium 2-(4,7-diphenyl-1,10-phenanthrolin-1-ium-2-yl)phenolate.
Molecular Properties
| Compound Name | lithium 2-(4,7-diphenyl-1,10-phenanthrolin-1-ium-2-yl)phenolate |
| PubChem CID | 59156368 |
| Molecular Formula | C30H20LiN2O+ |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | lithium 2-(4,7-diphenyl-1,10-phenanthrolin-1-ium-2-yl)phenolate |
| SMILES | [Li+].[O-]c1ccccc1-c1cc(-c2ccccc2)c2ccc3c(-c4ccccc4)ccnc3c2[nH+]1 |
| InChI | InChI=1S/C30H20N2O.Li/c33-28-14-8-7-13-25(28)27-19-26(21-11-5-2-6-12-21)24-16-15-23-22(20-9-3-1-4-10-20)17-18-31-29(23)30(24)32-27;/h1-19,33H;/q;+1 |
| InChIKey | CKEOCBVQNGQGID-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze lithium 2-(4,7-diphenyl-1,10-phenanthrolin-1-ium-2-yl)phenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-(4,7-diphenyl-1,10-phenanthrolin-1-ium-2-yl)phenolate?
The IUPAC name of lithium 2-(4,7-diphenyl-1,10-phenanthrolin-1-ium-2-yl)phenolate (CID 59156368) is lithium 2-(4,7-diphenyl-1,10-phenanthrolin-1-ium-2-yl)phenolate.
What is the SMILES notation for lithium 2-(4,7-diphenyl-1,10-phenanthrolin-1-ium-2-yl)phenolate?
The canonical SMILES for lithium 2-(4,7-diphenyl-1,10-phenanthrolin-1-ium-2-yl)phenolate is [Li+].[O-]c1ccccc1-c1cc(-c2ccccc2)c2ccc3c(-c4ccccc4)ccnc3c2[nH+]1.
What is the InChIKey of lithium 2-(4,7-diphenyl-1,10-phenanthrolin-1-ium-2-yl)phenolate?
The InChIKey is CKEOCBVQNGQGID-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H20N2O.Li/c33-28-14-8-7-13-25(28)27-19-26(21-11-5-2-6-12-21)24-16-15-23-22(20-9-3-1-4-10-20)17-18-31-29(23)30(24)32-27;/h1-19,33H;/q;+1.
What are the key properties of lithium 2-(4,7-diphenyl-1,10-phenanthrolin-1-ium-2-yl)phenolate?
lithium 2-(4,7-diphenyl-1,10-phenanthrolin-1-ium-2-yl)phenolate has a molecular weight of 431.44 g/mol, XLogP of 3.28, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-(4,7-diphenyl-1,10-phenanthrolin-1-ium-2-yl)phenolate is sourced from PubChem (CID 59156368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).