C17H11ClN2O3 — CID 59156839
10a-(4-chlorophenyl)-1,10-dihydroimidazo[1,2-b]isoquinoline-2,3,5-trione (PubChem CID 59156839) has the molecular formula C17H11ClN2O3 and a molecular weight of 326.74 g/mol. Its IUPAC name is 10a-(4-chlorophenyl)-1,10-dihydroimidazo[1,2-b]isoquinoline-2,3,5-trione.
| Compound Name | 10a-(4-chlorophenyl)-1,10-dihydroimidazo[1,2-b]isoquinoline-2,3,5-trione |
|---|---|
| PubChem CID | 59156839 |
| Molecular Formula | C17H11ClN2O3 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 10a-(4-chlorophenyl)-1,10-dihydroimidazo[1,2-b]isoquinoline-2,3,5-trione |
| SMILES | O=C1NC2(c3ccc(Cl)cc3)Cc3ccccc3C(=O)N2C1=O |
| InChI | InChI=1S/C17H11ClN2O3/c18-12-7-5-11(6-8-12)17-9-10-3-1-2-4-13(10)15(22)20(17)16(23)14(21)19-17/h1-8H,9H2,(H,19,21) |
| InChIKey | KCVDAKYRJGKDRI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|