C16H20F14O — CID 59156988
3-(1,1-difluoroethyl)-3-[[2-(1,1-difluoroethyl)-2-ethyl-1,1,3,3-tetrafluorobutoxy]-difluoromethyl]-2,2,4,4-tetrafluoropentane (PubChem CID 59156988) has the molecular formula C16H20F14O and a molecular weight of 494.31 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-3-[[2-(1,1-difluoroethyl)-2-ethyl-1,1,3,3-tetrafluorobutoxy]-difluoromethyl]-2,2,4,4-tetrafluoropentane.
| Compound Name | 3-(1,1-difluoroethyl)-3-[[2-(1,1-difluoroethyl)-2-ethyl-1,1,3,3-tetrafluorobutoxy]-difluoromethyl]-2,2,4,4-tetrafluoropentane |
|---|---|
| PubChem CID | 59156988 |
| Molecular Formula | C16H20F14O |
| Molecular Weight | 494.31 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 3-(1,1-difluoroethyl)-3-[[2-(1,1-difluoroethyl)-2-ethyl-1,1,3,3-tetrafluorobutoxy]-difluoromethyl]-2,2,4,4-tetrafluoropentane |
| SMILES | CCC(C(C)(F)F)(C(C)(F)F)C(F)(F)OC(F)(F)C(C(C)(F)F)(C(C)(F)F)C(C)(F)F |
| InChI | InChI=1S/C16H20F14O/c1-7-13(8(2,17)18,9(3,19)20)15(27,28)31-16(29,30)14(10(4,21)22,11(5,23)24)12(6,25)26/h7H2,1-6H3 |
| InChIKey | LQIZRSIRDQDTQZ-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.31 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |