About carbanide;nickel(3+);propan-2-yl(prop-1-en-2-yl)azanide
carbanide;nickel(3+);propan-2-yl(prop-1-en-2-yl)azanide (PubChem CID 59157020) has the molecular formula C7H14NNi
and a molecular weight of 170.89 g/mol. Its IUPAC name is carbanide;nickel(3+);propan-2-yl(prop-1-en-2-yl)azanide.
Molecular Properties
| Compound Name | carbanide;nickel(3+);propan-2-yl(prop-1-en-2-yl)azanide |
| PubChem CID | 59157020 |
| Molecular Formula | C7H14NNi |
| Molecular Weight | 170.89 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | carbanide;nickel(3+);propan-2-yl(prop-1-en-2-yl)azanide |
| SMILES | [CH3-].[H]/[C-]=C(\C)[N-]C(C)C.[Ni+3] |
| InChI | InChI=1S/C6H11N.CH3.Ni/c1-5(2)7-6(3)4;;/h1,6H,2-4H3;1H3;/q-2;-1;+3 |
| InChIKey | ZLNRBJCGSFTRRU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.89 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;nickel(3+);propan-2-yl(prop-1-en-2-yl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;nickel(3+);propan-2-yl(prop-1-en-2-yl)azanide?
The IUPAC name of carbanide;nickel(3+);propan-2-yl(prop-1-en-2-yl)azanide (CID 59157020) is carbanide;nickel(3+);propan-2-yl(prop-1-en-2-yl)azanide.
What is the SMILES notation for carbanide;nickel(3+);propan-2-yl(prop-1-en-2-yl)azanide?
The canonical SMILES for carbanide;nickel(3+);propan-2-yl(prop-1-en-2-yl)azanide is [CH3-].[H]/[C-]=C(\C)[N-]C(C)C.[Ni+3].
What is the InChIKey of carbanide;nickel(3+);propan-2-yl(prop-1-en-2-yl)azanide?
The InChIKey is ZLNRBJCGSFTRRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N.CH3.Ni/c1-5(2)7-6(3)4;;/h1,6H,2-4H3;1H3;/q-2;-1;+3.
What are the key properties of carbanide;nickel(3+);propan-2-yl(prop-1-en-2-yl)azanide?
carbanide;nickel(3+);propan-2-yl(prop-1-en-2-yl)azanide has a molecular weight of 170.89 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;nickel(3+);propan-2-yl(prop-1-en-2-yl)azanide is sourced from PubChem (CID 59157020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).