About spiro[5.5]undecan-4-yl 4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]benzoate
spiro[5.5]undecan-4-yl 4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]benzoate (PubChem CID 59157182) has the molecular formula C21H26F3NO2
and a molecular weight of 381.44 g/mol. Its IUPAC name is spiro[5.5]undecan-4-yl 4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]benzoate.
Molecular Properties
| Compound Name | spiro[5.5]undecan-4-yl 4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]benzoate |
| PubChem CID | 59157182 |
| Molecular Formula | C21H26F3NO2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | spiro[5.5]undecan-4-yl 4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]benzoate |
| SMILES | C/N=C(\c1ccc(C(=O)OC2CCCC3(CCCCC3)C2)cc1)C(F)(F)F |
| InChI | InChI=1S/C21H26F3NO2/c1-25-18(21(22,23)24)15-7-9-16(10-8-15)19(26)27-17-6-5-13-20(14-17)11-3-2-4-12-20/h7-10,17H,2-6,11-14H2,1H3/b25-18+ |
| InChIKey | CQOJGISEVITVMP-XIEYBQDHSA-N |
| XLogP | 5.72 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze spiro[5.5]undecan-4-yl 4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[5.5]undecan-4-yl 4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]benzoate?
The IUPAC name of spiro[5.5]undecan-4-yl 4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]benzoate (CID 59157182) is spiro[5.5]undecan-4-yl 4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]benzoate.
What is the SMILES notation for spiro[5.5]undecan-4-yl 4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]benzoate?
The canonical SMILES for spiro[5.5]undecan-4-yl 4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]benzoate is C/N=C(\c1ccc(C(=O)OC2CCCC3(CCCCC3)C2)cc1)C(F)(F)F.
What is the InChIKey of spiro[5.5]undecan-4-yl 4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]benzoate?
The InChIKey is CQOJGISEVITVMP-XIEYBQDHSA-N. The full InChI is InChI=1S/C21H26F3NO2/c1-25-18(21(22,23)24)15-7-9-16(10-8-15)19(26)27-17-6-5-13-20(14-17)11-3-2-4-12-20/h7-10,17H,2-6,11-14H2,1H3/b25-18+.
What are the key properties of spiro[5.5]undecan-4-yl 4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]benzoate?
spiro[5.5]undecan-4-yl 4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]benzoate has a molecular weight of 381.44 g/mol, XLogP of 5.72, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[5.5]undecan-4-yl 4-[N-methyl-C-(trifluoromethyl)carbonimidoyl]benzoate is sourced from PubChem (CID 59157182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).